C23H28O2 — CID 101159547
(4aS,8aS)-3,4a,8,8-tetramethyl-4-[(E)-3-phenylprop-2-enoyl]-5,6,7,8a-tetrahydro-1H-naphthalen-2-one (PubChem CID 101159547) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is (4aS,8aS)-3,4a,8,8-tetramethyl-4-[(E)-3-phenylprop-2-enoyl]-5,6,7,8a-tetrahydro-1H-naphthalen-2-one.
| Compound Name | (4aS,8aS)-3,4a,8,8-tetramethyl-4-[(E)-3-phenylprop-2-enoyl]-5,6,7,8a-tetrahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 101159547 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (4aS,8aS)-3,4a,8,8-tetramethyl-4-[(E)-3-phenylprop-2-enoyl]-5,6,7,8a-tetrahydro-1H-naphthalen-2-one |
| SMILES | CC1=C(C(=O)/C=C/c2ccccc2)[C@@]2(C)CCCC(C)(C)[C@@H]2CC1=O |
| InChI | InChI=1S/C23H28O2/c1-16-19(25)15-20-22(2,3)13-8-14-23(20,4)21(16)18(24)12-11-17-9-6-5-7-10-17/h5-7,9-12,20H,8,13-15H2,1-4H3/b12-11+/t20-,23-/m0/s1 |
| InChIKey | DGVPAMWCPJHWGK-COPMYHSASA-N |
| XLogP | 5.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|