About (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate
(7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate (PubChem CID 22922395) has the molecular formula C17H20O5
and a molecular weight of 304.34 g/mol. Its IUPAC name is (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate.
Molecular Properties
| Compound Name | (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate |
| PubChem CID | 22922395 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate |
| SMILES | CC1=CC(OC(=O)c2ccc(O)cc2)C(O)C(C)(C)CC1=O |
| InChI | InChI=1S/C17H20O5/c1-10-8-14(15(20)17(2,3)9-13(10)19)22-16(21)11-4-6-12(18)7-5-11/h4-8,14-15,18,20H,9H2,1-3H3 |
| InChIKey | WRUGYJBCBYDBLU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate?
The IUPAC name of (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate (CID 22922395) is (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate.
What is the SMILES notation for (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate?
The canonical SMILES for (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate is CC1=CC(OC(=O)c2ccc(O)cc2)C(O)C(C)(C)CC1=O.
What is the InChIKey of (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate?
The InChIKey is WRUGYJBCBYDBLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O5/c1-10-8-14(15(20)17(2,3)9-13(10)19)22-16(21)11-4-6-12(18)7-5-11/h4-8,14-15,18,20H,9H2,1-3H3.
What are the key properties of (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate?
(7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate has a molecular weight of 304.34 g/mol, XLogP of 2.22, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-hydroxy-3,6,6-trimethyl-4-oxocyclohept-2-en-1-yl) 4-hydroxybenzoate is sourced from PubChem (CID 22922395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).