C18H20N2O8 — CID 22922345
(2-methoxy-4,7,7-trimethyl-5-oxocyclohept-3-en-1-yl) 2,4-dinitrobenzoate (PubChem CID 22922345) has the molecular formula C18H20N2O8 and a molecular weight of 392.36 g/mol. Its IUPAC name is (2-methoxy-4,7,7-trimethyl-5-oxocyclohept-3-en-1-yl) 2,4-dinitrobenzoate.
| Compound Name | (2-methoxy-4,7,7-trimethyl-5-oxocyclohept-3-en-1-yl) 2,4-dinitrobenzoate |
|---|---|
| PubChem CID | 22922345 |
| Molecular Formula | C18H20N2O8 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (2-methoxy-4,7,7-trimethyl-5-oxocyclohept-3-en-1-yl) 2,4-dinitrobenzoate |
| SMILES | COC1C=C(C)C(=O)CC(C)(C)C1OC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N2O8/c1-10-7-15(27-4)16(18(2,3)9-14(10)21)28-17(22)12-6-5-11(19(23)24)8-13(12)20(25)26/h5-8,15-16H,9H2,1-4H3 |
| InChIKey | YTFZDZLBMCMUFC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|