C21H18N2O10 — CID 101139220
methyl 2-[2-[(3S)-4,4-dimethyl-2-oxooxolan-3-yl]oxycarbonyl-5-nitrophenyl]-4-nitrobenzoate (PubChem CID 101139220) has the molecular formula C21H18N2O10 and a molecular weight of 458.38 g/mol. Its IUPAC name is methyl 2-[2-[(3S)-4,4-dimethyl-2-oxooxolan-3-yl]oxycarbonyl-5-nitrophenyl]-4-nitrobenzoate.
| Compound Name | methyl 2-[2-[(3S)-4,4-dimethyl-2-oxooxolan-3-yl]oxycarbonyl-5-nitrophenyl]-4-nitrobenzoate |
|---|---|
| PubChem CID | 101139220 |
| Molecular Formula | C21H18N2O10 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | methyl 2-[2-[(3S)-4,4-dimethyl-2-oxooxolan-3-yl]oxycarbonyl-5-nitrophenyl]-4-nitrobenzoate |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])cc1-c1cc([N+](=O)[O-])ccc1C(=O)O[C@@H]1C(=O)OCC1(C)C |
| InChI | InChI=1S/C21H18N2O10/c1-21(2)10-32-20(26)17(21)33-19(25)14-7-5-12(23(29)30)9-16(14)15-8-11(22(27)28)4-6-13(15)18(24)31-3/h4-9,17H,10H2,1-3H3/t17-/m1/s1 |
| InChIKey | HPRZAHIYRQLUQH-QGZVFWFLSA-N |
| XLogP | 3.07 |
| TPSA | 165.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|