C15H11N3O7 — CID 6302139
[(E)-(2,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 2,4-dinitrobenzoate (PubChem CID 6302139) has the molecular formula C15H11N3O7 and a molecular weight of 345.27 g/mol. Its IUPAC name is [(E)-(2,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 2,4-dinitrobenzoate.
| Compound Name | [(E)-(2,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 2,4-dinitrobenzoate |
|---|---|
| PubChem CID | 6302139 |
| Molecular Formula | C15H11N3O7 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | [(E)-(2,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 2,4-dinitrobenzoate |
| SMILES | CC1=C/C(=N\OC(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(C)=CC1=O |
| InChI | InChI=1S/C15H11N3O7/c1-8-6-14(19)9(2)5-12(8)16-25-15(20)11-4-3-10(17(21)22)7-13(11)18(23)24/h3-7H,1-2H3/b16-12+ |
| InChIKey | OLUBPUCGJJZGPH-FOWTUZBSSA-N |
| XLogP | 2.49 |
| TPSA | 142.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|