About cyclopropyl 4-hydroxybenzoate
cyclopropyl 4-hydroxybenzoate (PubChem CID 175929910) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is cyclopropyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | cyclopropyl 4-hydroxybenzoate |
| PubChem CID | 175929910 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | cyclopropyl 4-hydroxybenzoate |
| SMILES | O=C(OC1CC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H10O3/c11-8-3-1-7(2-4-8)10(12)13-9-5-6-9/h1-4,9,11H,5-6H2 |
| InChIKey | BQPOEMRMHGBWDJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl 4-hydroxybenzoate?
The IUPAC name of cyclopropyl 4-hydroxybenzoate (CID 175929910) is cyclopropyl 4-hydroxybenzoate.
What is the SMILES notation for cyclopropyl 4-hydroxybenzoate?
The canonical SMILES for cyclopropyl 4-hydroxybenzoate is O=C(OC1CC1)c1ccc(O)cc1.
What is the InChIKey of cyclopropyl 4-hydroxybenzoate?
The InChIKey is BQPOEMRMHGBWDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c11-8-3-1-7(2-4-8)10(12)13-9-5-6-9/h1-4,9,11H,5-6H2.
What are the key properties of cyclopropyl 4-hydroxybenzoate?
cyclopropyl 4-hydroxybenzoate has a molecular weight of 178.19 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl 4-hydroxybenzoate is sourced from PubChem (CID 175929910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).