C17H22O3 — CID 3317928
(1,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-hydroxybenzoate (PubChem CID 3317928) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (1,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-hydroxybenzoate.
| Compound Name | (1,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-hydroxybenzoate |
|---|---|
| PubChem CID | 3317928 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (1,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-hydroxybenzoate |
| SMILES | CC1(C)CC2(C)CC1CC2OC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H22O3/c1-16(2)10-17(3)9-12(16)8-14(17)20-15(19)11-4-6-13(18)7-5-11/h4-7,12,14,18H,8-10H2,1-3H3 |
| InChIKey | XIBTVJHMIMPXBL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |