C25H26O4 — CID 67894619
methyl 4-(4-hydroxybenzoyl)benzoate;tetracyclo[3.3.1.13,7.01,3]decane (PubChem CID 67894619) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is methyl 4-(4-hydroxybenzoyl)benzoate;tetracyclo[3.3.1.13,7.01,3]decane.
| Compound Name | methyl 4-(4-hydroxybenzoyl)benzoate;tetracyclo[3.3.1.13,7.01,3]decane |
|---|---|
| PubChem CID | 67894619 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | methyl 4-(4-hydroxybenzoyl)benzoate;tetracyclo[3.3.1.13,7.01,3]decane |
| SMILES | C1C2CC34CC1CC3(C2)C4.COC(=O)c1ccc(C(=O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C15H12O4.C10H14/c1-19-15(18)12-4-2-10(3-5-12)14(17)11-6-8-13(16)9-7-11;1-7-2-9-4-8(1)5-10(9,3-7)6-9/h2-9,16H,1H3;7-8H,1-6H2 |
| InChIKey | AAYMIISCEJCXER-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |