C19H21BrO4 — CID 7956909
(4-methoxycarbonylphenyl) (5S,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 7956909) has the molecular formula C19H21BrO4 and a molecular weight of 393.28 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) (5S,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) (5S,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7956909 |
| Molecular Formula | C19H21BrO4 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | (4-methoxycarbonylphenyl) (5S,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)C23C[C@@H]4C[C@@H](CC(Br)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H21BrO4/c1-23-16(21)14-2-4-15(5-3-14)24-17(22)18-7-12-6-13(8-18)10-19(20,9-12)11-18/h2-5,12-13H,6-11H2,1H3/t12-,13+,18?,19? |
| InChIKey | YUPSEUXVTUUYOP-NFAYLAGKSA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|