C19H21ClO3 — CID 2395151
(4-acetylphenyl) (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 2395151) has the molecular formula C19H21ClO3 and a molecular weight of 332.83 g/mol. Its IUPAC name is (4-acetylphenyl) (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | (4-acetylphenyl) (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 2395151 |
| Molecular Formula | C19H21ClO3 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (4-acetylphenyl) (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | CC(=O)c1ccc(OC(=O)C23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H21ClO3/c1-12(21)15-2-4-16(5-3-15)23-17(22)18-7-13-6-14(8-18)10-19(20,9-13)11-18/h2-5,13-14H,6-11H2,1H3/t13-,14+,18?,19? |
| InChIKey | AOYRXYUXFWWAEV-BAUKFBFWSA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|