C17H18ClNO4 — CID 8881373
(3-nitrophenyl) (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 8881373) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is (3-nitrophenyl) (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | (3-nitrophenyl) (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 8881373 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (3-nitrophenyl) (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | O=C(Oc1cccc([N+](=O)[O-])c1)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C17H18ClNO4/c18-17-8-11-4-12(9-17)7-16(6-11,10-17)15(20)23-14-3-1-2-13(5-14)19(21)22/h1-3,5,11-12H,4,6-10H2/t11-,12+,16?,17? |
| InChIKey | DYFWYKQSKCJLJE-GKUGFIGPSA-N |
| XLogP | 4.08 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|