C19H24ClNO5S — CID 98513907
2-(4-sulfamoylphenoxy)ethyl (5R,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 98513907) has the molecular formula C19H24ClNO5S and a molecular weight of 413.92 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl (5R,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl (5R,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98513907 |
| Molecular Formula | C19H24ClNO5S |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl (5R,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(OCCOC(=O)C23C[C@H]4C[C@@H](CC(Cl)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H24ClNO5S/c20-19-10-13-7-14(11-19)9-18(8-13,12-19)17(22)26-6-5-25-15-1-3-16(4-2-15)27(21,23)24/h1-4,13-14H,5-12H2,(H2,21,23,24)/t13-,14-,18?,19?/m1/s1 |
| InChIKey | OLMRNOLSHMAXTH-CXTCDGGRSA-N |
| XLogP | 2.83 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|