C24H29ClN2O4 — CID 98592685
[2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] (5S,7S)-3-chloroadamantane-1-carboxylate (PubChem CID 98592685) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] (5S,7S)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] (5S,7S)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98592685 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] (5S,7S)-3-chloroadamantane-1-carboxylate |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)COC(=O)C23C[C@@H]4C[C@H](CC(Cl)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H29ClN2O4/c1-2-30-20-6-4-19(5-7-20)27(9-3-8-26)21(28)15-31-22(29)23-11-17-10-18(12-23)14-24(25,13-17)16-23/h4-7,17-18H,2-3,9-16H2,1H3/t17-,18-,23?,24?/m0/s1 |
| InChIKey | XXAFXFJRSWSVCI-JSODFGIGSA-N |
| XLogP | 4.45 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|