C25H32N4O6 — CID 55311775
[2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 55311775) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 55311775 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)COC(=O)CN2C(=O)NC3(CCC(CC)CC3)C2=O)cc1 |
| InChI | InChI=1S/C25H32N4O6/c1-3-18-10-12-25(13-11-18)23(32)29(24(33)27-25)16-22(31)35-17-21(30)28(15-5-14-26)19-6-8-20(9-7-19)34-4-2/h6-9,18H,3-5,10-13,15-17H2,1-2H3,(H,27,33) |
| InChIKey | LSIQEMBOTIDTIS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|