C25H34N4O4 — CID 55354921
2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-cyanoethyl)-N-(4-ethoxyphenyl)acetamide (PubChem CID 55354921) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-cyanoethyl)-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-cyanoethyl)-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55354921 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-cyanoethyl)-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)CN2C(=O)NC3(CCC(C(C)(C)C)CC3)C2=O)cc1 |
| InChI | InChI=1S/C25H34N4O4/c1-5-33-20-9-7-19(8-10-20)28(16-6-15-26)21(30)17-29-22(31)25(27-23(29)32)13-11-18(12-14-25)24(2,3)4/h7-10,18H,5-6,11-14,16-17H2,1-4H3,(H,27,32) |
| InChIKey | NXWNRQORJQTVKY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|