C28H26N4O5 — CID 38858074
2-[4,4-bis(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-cyanoethyl)-N-phenylacetamide (PubChem CID 38858074) has the molecular formula C28H26N4O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is 2-[4,4-bis(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-cyanoethyl)-N-phenylacetamide.
| Compound Name | 2-[4,4-bis(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-cyanoethyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 38858074 |
| Molecular Formula | C28H26N4O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2-[4,4-bis(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-cyanoethyl)-N-phenylacetamide |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)NC(=O)N(CC(=O)N(CCC#N)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H26N4O5/c1-36-23-13-9-20(10-14-23)28(21-11-15-24(37-2)16-12-21)26(34)32(27(35)30-28)19-25(33)31(18-6-17-29)22-7-4-3-5-8-22/h3-5,7-16H,6,18-19H2,1-2H3,(H,30,35) |
| InChIKey | HJHFTHBOTUNYDS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|