C28H26N4O3 — CID 16569816
N-(2-cyanoethyl)-N-(3,5-dimethylphenyl)-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide (PubChem CID 16569816) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(3,5-dimethylphenyl)-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide.
| Compound Name | N-(2-cyanoethyl)-N-(3,5-dimethylphenyl)-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 16569816 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-(2-cyanoethyl)-N-(3,5-dimethylphenyl)-2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide |
| SMILES | Cc1cc(C)cc(N(CCC#N)C(=O)CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C28H26N4O3/c1-20-16-21(2)18-24(17-20)31(15-9-14-29)25(33)19-32-26(34)28(30-27(32)35,22-10-5-3-6-11-22)23-12-7-4-8-13-23/h3-8,10-13,16-18H,9,15,19H2,1-2H3,(H,30,35) |
| InChIKey | PFFFLQBALJOZKY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|