C25H21N3O4 — CID 2121699
4-[[4,4-bis(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]methyl]benzonitrile (PubChem CID 2121699) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-[[4,4-bis(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4,4-bis(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 2121699 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-[[4,4-bis(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]methyl]benzonitrile |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)NC(=O)N(Cc3ccc(C#N)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H21N3O4/c1-31-21-11-7-19(8-12-21)25(20-9-13-22(32-2)14-10-20)23(29)28(24(30)27-25)16-18-5-3-17(15-26)4-6-18/h3-14H,16H2,1-2H3,(H,27,30) |
| InChIKey | IFORVODMNKOWFU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|