C27H24N4O5 — CID 38827168
5,5-bis(4-methoxyphenyl)-3-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]imidazolidine-2,4-dione (PubChem CID 38827168) has the molecular formula C27H24N4O5 and a molecular weight of 484.51 g/mol. Its IUPAC name is 5,5-bis(4-methoxyphenyl)-3-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-bis(4-methoxyphenyl)-3-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 38827168 |
| Molecular Formula | C27H24N4O5 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 5,5-bis(4-methoxyphenyl)-3-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)NC(=O)N(Cc3nnc(-c4ccc(C)cc4)o3)C2=O)cc1 |
| InChI | InChI=1S/C27H24N4O5/c1-17-4-6-18(7-5-17)24-30-29-23(36-24)16-31-25(32)27(28-26(31)33,19-8-12-21(34-2)13-9-19)20-10-14-22(35-3)15-11-20/h4-15H,16H2,1-3H3,(H,28,33) |
| InChIKey | RKYRWCWUYXAXRY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|