C26H27N3O3S2 — CID 6203567
N-(2-cyanoethyl)-6-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylhexanamide (PubChem CID 6203567) has the molecular formula C26H27N3O3S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is N-(2-cyanoethyl)-6-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylhexanamide.
| Compound Name | N-(2-cyanoethyl)-6-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylhexanamide |
|---|---|
| PubChem CID | 6203567 |
| Molecular Formula | C26H27N3O3S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | N-(2-cyanoethyl)-6-[(5Z)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylhexanamide |
| SMILES | COc1ccc(/C=C2\SC(=S)N(CCCCCC(=O)N(CCC#N)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H27N3O3S2/c1-32-22-14-12-20(13-15-22)19-23-25(31)29(26(33)34-23)17-7-3-6-11-24(30)28(18-8-16-27)21-9-4-2-5-10-21/h2,4-5,9-10,12-15,19H,3,6-8,11,17-18H2,1H3/b23-19- |
| InChIKey | XBQFSXKTWREAKR-NMWGTECJSA-N |
| XLogP | 5.40 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|