C27H29N3O4S2 — CID 4759287
N-(2-cyanoethyl)-6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylhexanamide (PubChem CID 4759287) has the molecular formula C27H29N3O4S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is N-(2-cyanoethyl)-6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylhexanamide.
| Compound Name | N-(2-cyanoethyl)-6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylhexanamide |
|---|---|
| PubChem CID | 4759287 |
| Molecular Formula | C27H29N3O4S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | N-(2-cyanoethyl)-6-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylhexanamide |
| SMILES | COc1ccc(C=C2SC(=S)N(CCCCCC(=O)N(CCC#N)c3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C27H29N3O4S2/c1-33-22-14-13-20(18-23(22)34-2)19-24-26(32)30(27(35)36-24)16-8-4-7-12-25(31)29(17-9-15-28)21-10-5-3-6-11-21/h3,5-6,10-11,13-14,18-19H,4,7-9,12,16-17H2,1-2H3 |
| InChIKey | YVOPSLQYPAFMHA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|