C29H26N2O4S2 — CID 6203060
methyl 4-[(Z)-[3-[4-(N-benzylanilino)-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 6203060) has the molecular formula C29H26N2O4S2 and a molecular weight of 530.67 g/mol. Its IUPAC name is methyl 4-[(Z)-[3-[4-(N-benzylanilino)-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[3-[4-(N-benzylanilino)-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 6203060 |
| Molecular Formula | C29H26N2O4S2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | methyl 4-[(Z)-[3-[4-(N-benzylanilino)-4-oxobutyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2\SC(=S)N(CCCC(=O)N(Cc3ccccc3)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C29H26N2O4S2/c1-35-28(34)23-16-14-21(15-17-23)19-25-27(33)30(29(36)37-25)18-8-13-26(32)31(24-11-6-3-7-12-24)20-22-9-4-2-5-10-22/h2-7,9-12,14-17,19H,8,13,18,20H2,1H3/b25-19- |
| InChIKey | IGSOQZOCIQFOGP-PLRJNAJWSA-N |
| XLogP | 5.69 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|