C22H28N2O5S2 — CID 4759551
methyl 4-[[3-[6-[ethyl(2-hydroxyethyl)amino]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 4759551) has the molecular formula C22H28N2O5S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is methyl 4-[[3-[6-[ethyl(2-hydroxyethyl)amino]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[[3-[6-[ethyl(2-hydroxyethyl)amino]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 4759551 |
| Molecular Formula | C22H28N2O5S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | methyl 4-[[3-[6-[ethyl(2-hydroxyethyl)amino]-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | CCN(CCO)C(=O)CCCCCN1C(=O)C(=Cc2ccc(C(=O)OC)cc2)SC1=S |
| InChI | InChI=1S/C22H28N2O5S2/c1-3-23(13-14-25)19(26)7-5-4-6-12-24-20(27)18(31-22(24)30)15-16-8-10-17(11-9-16)21(28)29-2/h8-11,15,25H,3-7,12-14H2,1-2H3 |
| InChIKey | WBJDQDGOLCXXIA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|