C25H28N2O3S2 — CID 6203321
N-benzyl-6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-hydroxyethyl)hexanamide (PubChem CID 6203321) has the molecular formula C25H28N2O3S2 and a molecular weight of 468.64 g/mol. Its IUPAC name is N-benzyl-6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-hydroxyethyl)hexanamide.
| Compound Name | N-benzyl-6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-hydroxyethyl)hexanamide |
|---|---|
| PubChem CID | 6203321 |
| Molecular Formula | C25H28N2O3S2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | N-benzyl-6-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-hydroxyethyl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)/C(=C/c2ccccc2)SC1=S)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C25H28N2O3S2/c28-17-16-26(19-21-12-6-2-7-13-21)23(29)14-8-3-9-15-27-24(30)22(32-25(27)31)18-20-10-4-1-5-11-20/h1-2,4-7,10-13,18,28H,3,8-9,14-17,19H2/b22-18- |
| InChIKey | ZKAQENANAZJMPV-PYCFMQQDSA-N |
| XLogP | 4.47 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|