C25H28N2O4S2 — CID 2770717
N-benzyl-4-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-hydroxyethyl)butanamide (PubChem CID 2770717) has the molecular formula C25H28N2O4S2 and a molecular weight of 484.64 g/mol. Its IUPAC name is N-benzyl-4-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-hydroxyethyl)butanamide.
| Compound Name | N-benzyl-4-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-hydroxyethyl)butanamide |
|---|---|
| PubChem CID | 2770717 |
| Molecular Formula | C25H28N2O4S2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-benzyl-4-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-hydroxyethyl)butanamide |
| SMILES | CCOc1ccc(C=C2SC(=S)N(CCCC(=O)N(CCO)Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H28N2O4S2/c1-2-31-21-12-10-19(11-13-21)17-22-24(30)27(25(32)33-22)14-6-9-23(29)26(15-16-28)18-20-7-4-3-5-8-20/h3-5,7-8,10-13,17,28H,2,6,9,14-16,18H2,1H3 |
| InChIKey | XVEXTDYVAAZBCD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|