C26H28N2O5S2 — CID 4759415
6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-benzyl-N-(2-hydroxyethyl)hexanamide (PubChem CID 4759415) has the molecular formula C26H28N2O5S2 and a molecular weight of 512.65 g/mol. Its IUPAC name is 6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-benzyl-N-(2-hydroxyethyl)hexanamide.
| Compound Name | 6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-benzyl-N-(2-hydroxyethyl)hexanamide |
|---|---|
| PubChem CID | 4759415 |
| Molecular Formula | C26H28N2O5S2 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 6-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-benzyl-N-(2-hydroxyethyl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)C(=Cc2ccc3c(c2)OCO3)SC1=S)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C26H28N2O5S2/c29-14-13-27(17-19-7-3-1-4-8-19)24(30)9-5-2-6-12-28-25(31)23(35-26(28)34)16-20-10-11-21-22(15-20)33-18-32-21/h1,3-4,7-8,10-11,15-16,29H,2,5-6,9,12-14,17-18H2 |
| InChIKey | VNQZJKNDVVASRT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|