C29H32N2O4S2 — CID 4759353
5-(1,3-benzodioxol-5-ylmethylidene)-3-[6-(4-benzylpiperidin-1-yl)-6-oxohexyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4759353) has the molecular formula C29H32N2O4S2 and a molecular weight of 536.72 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylidene)-3-[6-(4-benzylpiperidin-1-yl)-6-oxohexyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylidene)-3-[6-(4-benzylpiperidin-1-yl)-6-oxohexyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4759353 |
| Molecular Formula | C29H32N2O4S2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylidene)-3-[6-(4-benzylpiperidin-1-yl)-6-oxohexyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C(CCCCCN1C(=O)C(=Cc2ccc3c(c2)OCO3)SC1=S)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H32N2O4S2/c32-27(30-15-12-22(13-16-30)17-21-7-3-1-4-8-21)9-5-2-6-14-31-28(33)26(37-29(31)36)19-23-10-11-24-25(18-23)35-20-34-24/h1,3-4,7-8,10-11,18-19,22H,2,5-6,9,12-17,20H2 |
| InChIKey | DVEIGGLCHNEMAT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|