C25H26N2O4S2 — CID 1383504
3-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-benzyl-N-tert-butylpropanamide (PubChem CID 1383504) has the molecular formula C25H26N2O4S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 3-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-benzyl-N-tert-butylpropanamide.
| Compound Name | 3-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-benzyl-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 1383504 |
| Molecular Formula | C25H26N2O4S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 3-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-benzyl-N-tert-butylpropanamide |
| SMILES | CC(C)(C)N(Cc1ccccc1)C(=O)CCN1C(=O)C(=Cc2ccc3c(c2)OCO3)SC1=S |
| InChI | InChI=1S/C25H26N2O4S2/c1-25(2,3)27(15-17-7-5-4-6-8-17)22(28)11-12-26-23(29)21(33-24(26)32)14-18-9-10-19-20(13-18)31-16-30-19/h4-10,13-14H,11-12,15-16H2,1-3H3 |
| InChIKey | GFJMJADENDIKTQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|