C25H27ClN2O2S2 — CID 4759680
N-benzyl-6-[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-ethylhexanamide (PubChem CID 4759680) has the molecular formula C25H27ClN2O2S2 and a molecular weight of 487.09 g/mol. Its IUPAC name is N-benzyl-6-[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-ethylhexanamide.
| Compound Name | N-benzyl-6-[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-ethylhexanamide |
|---|---|
| PubChem CID | 4759680 |
| Molecular Formula | C25H27ClN2O2S2 |
| Molecular Weight | 487.09 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-benzyl-6-[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-ethylhexanamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CCCCCN1C(=O)C(=Cc2ccc(Cl)cc2)SC1=S |
| InChI | InChI=1S/C25H27ClN2O2S2/c1-2-27(18-20-9-5-3-6-10-20)23(29)11-7-4-8-16-28-24(30)22(32-25(28)31)17-19-12-14-21(26)15-13-19/h3,5-6,9-10,12-15,17H,2,4,7-8,11,16,18H2,1H3 |
| InChIKey | ABIGXFMTYIKBEY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.09 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|