C21H26ClNO4 — CID 29246551
2-(4-chlorophenoxy)ethyl (5S,7R)-3-acetamidoadamantane-1-carboxylate (PubChem CID 29246551) has the molecular formula C21H26ClNO4 and a molecular weight of 391.90 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl (5S,7R)-3-acetamidoadamantane-1-carboxylate.
| Compound Name | 2-(4-chlorophenoxy)ethyl (5S,7R)-3-acetamidoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 29246551 |
| Molecular Formula | C21H26ClNO4 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl (5S,7R)-3-acetamidoadamantane-1-carboxylate |
| SMILES | CC(=O)NC12C[C@H]3C[C@@H](C1)CC(C(=O)OCCOc1ccc(Cl)cc1)(C3)C2 |
| InChI | InChI=1S/C21H26ClNO4/c1-14(24)23-21-11-15-8-16(12-21)10-20(9-15,13-21)19(25)27-7-6-26-18-4-2-17(22)3-5-18/h2-5,15-16H,6-13H2,1H3,(H,23,24)/t15-,16+,20?,21? |
| InChIKey | JGFGKURBLKSBBA-XBLGPDGASA-N |
| XLogP | 3.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|