C23H27ClO3 — CID 7843933
[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 7843933) has the molecular formula C23H27ClO3 and a molecular weight of 386.92 g/mol. Its IUPAC name is [2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7843933 |
| Molecular Formula | C23H27ClO3 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H27ClO3/c24-23-11-15-7-16(12-23)10-22(9-15,14-23)21(26)27-13-20(25)19-6-5-17-3-1-2-4-18(17)8-19/h5-6,8,15-16H,1-4,7,9-14H2/t15-,16+,22?,23? |
| InChIKey | OEROGSFMQMGLJH-IWENEADUSA-N |
| XLogP | 4.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|