C23H28O3 — CID 7695233
[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(1-adamantyl)acetate (PubChem CID 7695233) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(1-adamantyl)acetate.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(1-adamantyl)acetate |
|---|---|
| PubChem CID | 7695233 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl] 2-(1-adamantyl)acetate |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)OCC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C23H28O3/c24-21(20-5-4-18-2-1-3-19(18)9-20)14-26-22(25)13-23-10-15-6-16(11-23)8-17(7-15)12-23/h4-5,9,15-17H,1-3,6-8,10-14H2 |
| InChIKey | PGIPADKSQJVODG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |