C10H18O3 — CID 91701869
(2R,5R)-2-tert-butyl-5-propan-2-yl-1,3-dioxolan-4-one (PubChem CID 91701869) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2R,5R)-2-tert-butyl-5-propan-2-yl-1,3-dioxolan-4-one.
| Compound Name | (2R,5R)-2-tert-butyl-5-propan-2-yl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 91701869 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (2R,5R)-2-tert-butyl-5-propan-2-yl-1,3-dioxolan-4-one |
| SMILES | CC(C)[C@H]1O[C@@H](C(C)(C)C)OC1=O |
| InChI | InChI=1S/C10H18O3/c1-6(2)7-8(11)13-9(12-7)10(3,4)5/h6-7,9H,1-5H3/t7-,9-/m1/s1 |
| InChIKey | DIUPQZZJBTXSAD-VXNVDRBHSA-N |
| XLogP | 1.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |