C16H28O3Si — CID 134983316
(2R,5S,6R)-2-tert-butyl-6-methyl-5-(3-trimethylsilylbuta-1,2-dienyl)-1,3-dioxan-4-one (PubChem CID 134983316) has the molecular formula C16H28O3Si and a molecular weight of 296.48 g/mol. Its IUPAC name is (2R,5S,6R)-2-tert-butyl-6-methyl-5-(3-trimethylsilylbuta-1,2-dienyl)-1,3-dioxan-4-one.
| Compound Name | (2R,5S,6R)-2-tert-butyl-6-methyl-5-(3-trimethylsilylbuta-1,2-dienyl)-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 134983316 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (2R,5S,6R)-2-tert-butyl-6-methyl-5-(3-trimethylsilylbuta-1,2-dienyl)-1,3-dioxan-4-one |
| SMILES | CC(=C=C[C@@H]1C(=O)O[C@H](C(C)(C)C)O[C@@H]1C)[Si](C)(C)C |
| InChI | InChI=1S/C16H28O3Si/c1-11(20(6,7)8)9-10-13-12(2)18-15(16(3,4)5)19-14(13)17/h10,12-13,15H,1-8H3/t9?,12-,13+,15-/m1/s1 |
| InChIKey | KQUSTYRLCSQGAH-JICPXENXSA-N |
| XLogP | 3.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|