C18H24O6 — CID 25178871
(2R)-2-[(2R,4R)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]-4-phenylmethoxybutanoic acid (PubChem CID 25178871) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is (2R)-2-[(2R,4R)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]-4-phenylmethoxybutanoic acid.
| Compound Name | (2R)-2-[(2R,4R)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 25178871 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2R)-2-[(2R,4R)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]-4-phenylmethoxybutanoic acid |
| SMILES | CC(C)(C)[C@H]1OC(=O)[C@@H](C(CCOCc2ccccc2)C(=O)O)O1 |
| InChI | InChI=1S/C18H24O6/c1-18(2,3)17-23-14(16(21)24-17)13(15(19)20)9-10-22-11-12-7-5-4-6-8-12/h4-8,13-14,17H,9-11H2,1-3H3,(H,19,20)/t13?,14-,17-/m1/s1 |
| InChIKey | RMYOTYWAAJVQHD-DTLKIFBZSA-N |
| XLogP | 2.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|