C16H19FO4 — CID 177478301
2-[(2S)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]-3-phenylpropanoyl fluoride (PubChem CID 177478301) has the molecular formula C16H19FO4 and a molecular weight of 294.32 g/mol. Its IUPAC name is 2-[(2S)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]-3-phenylpropanoyl fluoride.
| Compound Name | 2-[(2S)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]-3-phenylpropanoyl fluoride |
|---|---|
| PubChem CID | 177478301 |
| Molecular Formula | C16H19FO4 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-[(2S)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]-3-phenylpropanoyl fluoride |
| SMILES | CC(C)(C)[C@@H]1OC(=O)C(C(Cc2ccccc2)C(=O)F)O1 |
| InChI | InChI=1S/C16H19FO4/c1-16(2,3)15-20-12(14(19)21-15)11(13(17)18)9-10-7-5-4-6-8-10/h4-8,11-12,15H,9H2,1-3H3/t11?,12?,15-/m0/s1 |
| InChIKey | ASOUMWRQJXNAMJ-QOZQQMKHSA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|