C13H20O2Si — CID 134987697
(1R)-2-phenyl-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]ethanol (PubChem CID 134987697) has the molecular formula C13H20O2Si and a molecular weight of 236.39 g/mol. Its IUPAC name is (1R)-2-phenyl-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]ethanol.
| Compound Name | (1R)-2-phenyl-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]ethanol |
|---|---|
| PubChem CID | 134987697 |
| Molecular Formula | C13H20O2Si |
| Molecular Weight | 236.39 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (1R)-2-phenyl-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]ethanol |
| SMILES | C[Si](C)(C)[C@@H]1O[C@H]1[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C13H20O2Si/c1-16(2,3)13-12(15-13)11(14)9-10-7-5-4-6-8-10/h4-8,11-14H,9H2,1-3H3/t11-,12+,13+/m1/s1 |
| InChIKey | WSKIGUIIGMDUKH-AGIUHOORSA-N |
| XLogP | 2.23 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|