C11H14O3 — CID 10241725
1-(1,3-dioxolan-2-yl)-2-phenylethanol (PubChem CID 10241725) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)-2-phenylethanol.
| Compound Name | 1-(1,3-dioxolan-2-yl)-2-phenylethanol |
|---|---|
| PubChem CID | 10241725 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)-2-phenylethanol |
| SMILES | OC(Cc1ccccc1)C1OCCO1 |
| InChI | InChI=1S/C11H14O3/c12-10(11-13-6-7-14-11)8-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2 |
| InChIKey | AKSMAOOJNLPOCV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |