C8H11I2NO4V — CID 158193630
diiodovanadium;(1R,4R,5S)-1-(1-hydroxyethyl)-4-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 158193630) has the molecular formula C8H11I2NO4V and a molecular weight of 489.93 g/mol. Its IUPAC name is diiodovanadium;(1R,4R,5S)-1-(1-hydroxyethyl)-4-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | diiodovanadium;(1R,4R,5S)-1-(1-hydroxyethyl)-4-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 158193630 |
| Molecular Formula | C8H11I2NO4V |
| Molecular Weight | 489.93 g/mol |
| Exact Mass | 489.82 |
| IUPAC Name | diiodovanadium;(1R,4R,5S)-1-(1-hydroxyethyl)-4-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | CC(O)[C@@]12NC(=O)[C@H](C)[C@@H]1OC2=O.I[V]I |
| InChI | InChI=1S/C8H11NO4.2HI.V/c1-3-5-8(4(2)10,7(12)13-5)9-6(3)11;;;/h3-5,10H,1-2H3,(H,9,11);2*1H;/q;;;+2/p-2/t3-,4?,5+,8-;;;/m1.../s1 |
| InChIKey | GABLQUXWFIMHBJ-OOYUMKGESA-L |
| XLogP | 0.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.93 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|