C9H15NO5 — CID 20588526
methyl 3-hydroxy-2-(1-hydroxyethyl)-4-methyl-5-oxopyrrolidine-2-carboxylate (PubChem CID 20588526) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is methyl 3-hydroxy-2-(1-hydroxyethyl)-4-methyl-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl 3-hydroxy-2-(1-hydroxyethyl)-4-methyl-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 20588526 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | methyl 3-hydroxy-2-(1-hydroxyethyl)-4-methyl-5-oxopyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1(C(C)O)NC(=O)C(C)C1O |
| InChI | InChI=1S/C9H15NO5/c1-4-6(12)9(5(2)11,8(14)15-3)10-7(4)13/h4-6,11-12H,1-3H3,(H,10,13) |
| InChIKey | OILKXZBWZWWTTA-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |