C6H7FN2O5 — CID 12890664
methyl (4S,5R)-5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxylate (PubChem CID 12890664) has the molecular formula C6H7FN2O5 and a molecular weight of 206.13 g/mol. Its IUPAC name is methyl (4S,5R)-5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxylate.
| Compound Name | methyl (4S,5R)-5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 12890664 |
| Molecular Formula | C6H7FN2O5 |
| Molecular Weight | 206.13 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | methyl (4S,5R)-5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxylate |
| SMILES | COC(=O)[C@]1(F)C(=O)NC(=O)N[C@H]1O |
| InChI | InChI=1S/C6H7FN2O5/c1-14-4(12)6(7)2(10)8-5(13)9-3(6)11/h2,10H,1H3,(H2,8,9,11,13)/t2-,6+/m0/s1 |
| InChIKey | JUUPPQURHPYPOI-LBNWCAIBSA-N |
| XLogP | -1.97 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.13 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|