C13H20FN3O5 — CID 173443435
ethyl 5-fluoro-4-(hexylideneamino)oxy-2,6-dioxo-1,3-diazinane-5-carboxylate (PubChem CID 173443435) has the molecular formula C13H20FN3O5 and a molecular weight of 317.32 g/mol. Its IUPAC name is ethyl 5-fluoro-4-(hexylideneamino)oxy-2,6-dioxo-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl 5-fluoro-4-(hexylideneamino)oxy-2,6-dioxo-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 173443435 |
| Molecular Formula | C13H20FN3O5 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | ethyl 5-fluoro-4-(hexylideneamino)oxy-2,6-dioxo-1,3-diazinane-5-carboxylate |
| SMILES | CCCCCC=NOC1NC(=O)NC(=O)C1(F)C(=O)OCC |
| InChI | InChI=1S/C13H20FN3O5/c1-3-5-6-7-8-15-22-10-13(14,11(19)21-4-2)9(18)16-12(20)17-10/h8,10H,3-7H2,1-2H3,(H2,16,17,18,20) |
| InChIKey | XJCNQYWGFSCEJM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|