About hexylidenecarbamothioic S-acid
hexylidenecarbamothioic S-acid (PubChem CID 91574516) has the molecular formula C7H13NOS
and a molecular weight of 159.25 g/mol. Its IUPAC name is hexylidenecarbamothioic S-acid.
Molecular Properties
| Compound Name | hexylidenecarbamothioic S-acid |
| PubChem CID | 91574516 |
| Molecular Formula | C7H13NOS |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | hexylidenecarbamothioic S-acid |
| SMILES | CCCCCC=NC(=O)S |
| InChI | InChI=1S/C7H13NOS/c1-2-3-4-5-6-8-7(9)10/h6H,2-5H2,1H3,(H,9,10) |
| InChIKey | ZOSIWARHWWUTCD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze hexylidenecarbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexylidenecarbamothioic S-acid?
The IUPAC name of hexylidenecarbamothioic S-acid (CID 91574516) is hexylidenecarbamothioic S-acid.
What is the SMILES notation for hexylidenecarbamothioic S-acid?
The canonical SMILES for hexylidenecarbamothioic S-acid is CCCCCC=NC(=O)S.
What is the InChIKey of hexylidenecarbamothioic S-acid?
The InChIKey is ZOSIWARHWWUTCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NOS/c1-2-3-4-5-6-8-7(9)10/h6H,2-5H2,1H3,(H,9,10).
What are the key properties of hexylidenecarbamothioic S-acid?
hexylidenecarbamothioic S-acid has a molecular weight of 159.25 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexylidenecarbamothioic S-acid is sourced from PubChem (CID 91574516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).