C5H6FN3O4 — CID 12890666
5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide (PubChem CID 12890666) has the molecular formula C5H6FN3O4 and a molecular weight of 191.12 g/mol. Its IUPAC name is 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide.
| Compound Name | 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 12890666 |
| Molecular Formula | C5H6FN3O4 |
| Molecular Weight | 191.12 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide |
| SMILES | NC(=O)C1(F)C(=O)NC(=O)NC1O |
| InChI | InChI=1S/C5H6FN3O4/c6-5(1(7)10)2(11)8-4(13)9-3(5)12/h2,11H,(H2,7,10)(H2,8,9,12,13) |
| InChIKey | FRKGVMPQSQNPCA-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.12 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|