About 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide
5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide (PubChem CID 12890666) has the molecular formula C5H6FN3O4
and a molecular weight of 191.12 g/mol. Its IUPAC name is 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide.
Molecular Properties
| Compound Name | 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide |
| PubChem CID | 12890666 |
| Molecular Formula | C5H6FN3O4 |
| Molecular Weight | 191.12 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide |
| SMILES | NC(=O)C1(F)C(=O)NC(=O)NC1O |
| InChI | InChI=1S/C5H6FN3O4/c6-5(1(7)10)2(11)8-4(13)9-3(5)12/h2,11H,(H2,7,10)(H2,8,9,12,13) |
| InChIKey | FRKGVMPQSQNPCA-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.12 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide?
The IUPAC name of 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide (CID 12890666) is 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide.
What is the SMILES notation for 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide?
The canonical SMILES for 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide is NC(=O)C1(F)C(=O)NC(=O)NC1O.
What is the InChIKey of 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide?
The InChIKey is FRKGVMPQSQNPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6FN3O4/c6-5(1(7)10)2(11)8-4(13)9-3(5)12/h2,11H,(H2,7,10)(H2,8,9,12,13).
What are the key properties of 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide?
5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide has a molecular weight of 191.12 g/mol, XLogP of -2.66, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-hydroxy-2,6-dioxo-1,3-diazinane-5-carboxamide is sourced from PubChem (CID 12890666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).