C3H4N2O3 — CID 40649061
(5S)-5-hydroxyimidazolidine-2,4-dione (PubChem CID 40649061) has the molecular formula C3H4N2O3 and a molecular weight of 116.08 g/mol. Its IUPAC name is (5S)-5-hydroxyimidazolidine-2,4-dione.
| Compound Name | (5S)-5-hydroxyimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40649061 |
| Molecular Formula | C3H4N2O3 |
| Molecular Weight | 116.08 g/mol |
| Exact Mass | 116.02 |
| IUPAC Name | (5S)-5-hydroxyimidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H](O)N1 |
| InChI | InChI=1S/C3H4N2O3/c6-1-2(7)5-3(8)4-1/h1,6H,(H2,4,5,7,8)/t1-/m0/s1 |
| InChIKey | WYLUZALOENCNQU-SFOWXEAESA-N |
| XLogP | -1.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.08 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|