C5H5IN2O4 — CID 45036974
5-iodo-2,6-dioxo-1,3-diazinane-4-carboxylic acid (PubChem CID 45036974) has the molecular formula C5H5IN2O4 and a molecular weight of 284.01 g/mol. Its IUPAC name is 5-iodo-2,6-dioxo-1,3-diazinane-4-carboxylic acid.
| Compound Name | 5-iodo-2,6-dioxo-1,3-diazinane-4-carboxylic acid |
|---|---|
| PubChem CID | 45036974 |
| Molecular Formula | C5H5IN2O4 |
| Molecular Weight | 284.01 g/mol |
| Exact Mass | 283.93 |
| IUPAC Name | 5-iodo-2,6-dioxo-1,3-diazinane-4-carboxylic acid |
| SMILES | O=C1NC(=O)C(I)C(C(=O)O)N1 |
| InChI | InChI=1S/C5H5IN2O4/c6-1-2(4(10)11)7-5(12)8-3(1)9/h1-2H,(H,10,11)(H2,7,8,9,12) |
| InChIKey | ZBGRHMKYZGGUJS-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.01 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|