C7H10N2O4 — CID 121449082
3-(2,5-dioxoimidazolidin-4-yl)-2-methylpropanoic acid (PubChem CID 121449082) has the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-4-yl)-2-methylpropanoic acid.
| Compound Name | 3-(2,5-dioxoimidazolidin-4-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 121449082 |
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)-2-methylpropanoic acid |
| SMILES | CC(CC1NC(=O)NC1=O)C(=O)O |
| InChI | InChI=1S/C7H10N2O4/c1-3(6(11)12)2-4-5(10)9-7(13)8-4/h3-4H,2H2,1H3,(H,11,12)(H2,8,9,10,13) |
| InChIKey | ZKUKTFWSXAWZNK-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|