C7H9F3N2O2 — CID 137408677
5-(3,3,3-trifluoro-2-methylpropyl)imidazolidine-2,4-dione (PubChem CID 137408677) has the molecular formula C7H9F3N2O2 and a molecular weight of 210.15 g/mol. Its IUPAC name is 5-(3,3,3-trifluoro-2-methylpropyl)imidazolidine-2,4-dione.
| Compound Name | 5-(3,3,3-trifluoro-2-methylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 137408677 |
| Molecular Formula | C7H9F3N2O2 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 5-(3,3,3-trifluoro-2-methylpropyl)imidazolidine-2,4-dione |
| SMILES | CC(CC1NC(=O)NC1=O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2O2/c1-3(7(8,9)10)2-4-5(13)12-6(14)11-4/h3-4H,2H2,1H3,(H2,11,12,13,14) |
| InChIKey | DDBWIOLFNGMRMK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|