C7H9NO3 — CID 70320136
(2S,3R)-4-oxo-3-prop-2-enylazetidine-2-carboxylic acid (PubChem CID 70320136) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is (2S,3R)-4-oxo-3-prop-2-enylazetidine-2-carboxylic acid.
| Compound Name | (2S,3R)-4-oxo-3-prop-2-enylazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70320136 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | (2S,3R)-4-oxo-3-prop-2-enylazetidine-2-carboxylic acid |
| SMILES | C=CC[C@H]1C(=O)N[C@@H]1C(=O)O |
| InChI | InChI=1S/C7H9NO3/c1-2-3-4-5(7(10)11)8-6(4)9/h2,4-5H,1,3H2,(H,8,9)(H,10,11)/t4-,5+/m1/s1 |
| InChIKey | NFSIYCNIWNYIGQ-UHNVWZDZSA-N |
| XLogP | -0.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|