C9H16NO4P — CID 58773470
(2R,3R,4R)-3-ethyl-5-oxo-4-(2-phosphanyloxyethyl)pyrrolidine-2-carboxylic acid (PubChem CID 58773470) has the molecular formula C9H16NO4P and a molecular weight of 233.20 g/mol. Its IUPAC name is (2R,3R,4R)-3-ethyl-5-oxo-4-(2-phosphanyloxyethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3R,4R)-3-ethyl-5-oxo-4-(2-phosphanyloxyethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58773470 |
| Molecular Formula | C9H16NO4P |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (2R,3R,4R)-3-ethyl-5-oxo-4-(2-phosphanyloxyethyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC[C@@H]1[C@@H](CCOP)C(=O)N[C@H]1C(=O)O |
| InChI | InChI=1S/C9H16NO4P/c1-2-5-6(3-4-14-15)8(11)10-7(5)9(12)13/h5-7H,2-4,15H2,1H3,(H,10,11)(H,12,13)/t5-,6-,7-/m1/s1 |
| InChIKey | LKKXHZDHTTWBTD-FSDSQADBSA-N |
| XLogP | 0.41 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|